Product Description
| Cat Number | HY-W035133 |
|---|---|
| Category | Biochemical Assay Reagent |
| Pack Size | 1 EA |
| Description | 5,10,15,20-Tetrakis(p-tolyl)porphyrin (TTP) is an organic compound belonging to the class of porphyrins, a cyclic molecule composed of four pyrrole rings linked together. TTP is a synthetic porphyrin commonly used as a sensitizer for dye-sensitized solar cells and a catalyst for organic reactions. Due to its unique structure, TTP has a series of interesting properties, including at specific wavelengths and its potential as a catalyst for various chemical reactions. In dye-sensitized solar cells, TTPs help convert sunlight into electricity by absorbing photons and transferring electrons to the semiconductor layer of the device. In organic chemistry, TTP is often used as a catalyst for various organic compounds in reactions such as oxidation and reduction. Its ability to selectively bind certain substrates makes it a useful tool for synthesizing complex molecules and studying their properties. |
| Molecular Weight | 670.84 |
| Research Field | Others |
| Purity | 97.0 |
| Formula | C48H38N4 |
| Smiles | CC1=CC=C(/C2=C3C=CC(/C(C4=CC=C(C)C=C4)=C(N/5)/C=CC5=C(C6=CC=C(C)C=C6)\C7=N/C(C=C7)=C(C8=CC=C(C)C=C8)\C9=CC=C2N9)=N\3)C=C1 |
| Scientific Background | Others |
| Storage | 4°C (Powder, protect from light, stored under nitrogen) |
| View Document | |
| Note | The product is for research use only |
Share Item: