Product Description
| Cat Number | HY-120967A |
|---|---|
| Category | Biochemical Assay Reagent |
| Pack Size | 1 EA |
| Description | (2S)-OMPT triethylamine, a chiral oxirane derivative, is commonly used as a ligand in asymmetric catalysis, especially in the enantioselective synthesis of bioactive molecules such as amino acids and drugs. (2S)-OMPT triethylamine has unique chemical properties that allow it to selectively bind certain metal complexes and activate them in a way that favors the formation of specific enantiomers. |
| Molecular Weight | 466.61 |
| Research Field | Others |
| Formula | C22H43O6PS |
| Smiles | CCCCCCCC/C=C\CCCCCCCC(OC[C@H](OC)COP(O)(S)=O)=O |
| Scientific Background | Others |
| View Document | |
| Note | The product is for research use only |
Share Item: