(2S)-OMPT (triethylamine), in ethanol:chloroform (1:1), 98%
SKU: BTL-MCE-B-88500 |
Brand: MedChem Express
Product Description
| Cat Number | HY-120967 |
|---|---|
| Category | Biochemical Assay Reagent |
| Pack Size | 1 EA |
| Description | (2S)-OMPT (triethylamine), in ethanol:chloroform (1:1), 98%, is commonly used as a ligand in asymmetric catalysis, especially in the enantioselective synthesis of bioactive molecules such as amino acids and drugs. (2S)-OMPT triethylamine has unique chemical properties that allow it to selectively bind certain metal complexes and activate them in a way that favors the formation of specific enantiomers. |
| Molecular Weight | 668.99 |
| Research Field | Others |
| Purity | 99.0 |
| Formula | C34H73N2O6PS |
| Smiles | O=C(CCCCCCC/C=C\CCCCCCCC)OC[C@@H](COP(O)(S)=O)OC.CCN(CC)CC.CCN(CC)CC |
| Scientific Background | Others |
| Storage | Solution, -20°C, 2 years |
| View Document | |
| Note | The product is for research use only |
Share Item: