Product Description
| Cat Number | HY-W133919 |
|---|---|
| Category | Dye Reagent |
| Pack Size | 1 EA |
| Description | Aniline Blue sodium is a water-soluble dye commonly used as a biological stain for the detection of nucleic acids and proteins in various laboratory procedures such as electrophoresis and microscopy. Aniline Blue sodium has unique chemical properties that allow it to bind to specific cellular components, producing a color change that facilitates their visualization and analysis. |
| Molecular Weight | 737.73 |
| Research Field | Others |
| Formula | C32H25N3Na2O9S3 |
| Smiles | CC1=CC(/C(C2=CC=C(NC3=CC=C(S(=O)(O[Na])=O)C=C3)C=C2)=C4C=C/C(C=C\4)=N/C5=CC=C(S(=O)(O)=O)C=C5)=CC(S(=O)(O[Na])=O)=C1N |
| Scientific Background | Others |
| Storage | 4°C (Powder, sealed storage, away from moisture and light) |
| View Document | |
| Note | The product is for research use only |
Share Item: